|
|
|
|
| LEADER |
01000naa a22002652 4500 |
| 001 |
NLM344251691 |
| 003 |
DE-627 |
| 005 |
20231226022330.0 |
| 007 |
cr uuu---uuuuu |
| 008 |
231226s2022 xx |||||o 00| ||eng c |
| 024 |
7 |
|
|a 10.1021/acs.langmuir.2c00907
|2 doi
|
| 028 |
5 |
2 |
|a pubmed24n1147.xml
|
| 035 |
|
|
|a (DE-627)NLM344251691
|
| 035 |
|
|
|a (NLM)35905457
|
| 040 |
|
|
|a DE-627
|b ger
|c DE-627
|e rakwb
|
| 041 |
|
|
|a eng
|
| 100 |
1 |
|
|a Xie, Lisi
|e verfasserin
|4 aut
|
| 245 |
1 |
0 |
|a Highly Efficient Bi4Ti3O12/g-C3N4/BiOBr Dual Z-Scheme Heterojunction Photocatalysts with Enhanced Visible Light-Responsive Activity for the Degradation of Antibiotics
|
| 264 |
|
1 |
|c 2022
|
| 336 |
|
|
|a Text
|b txt
|2 rdacontent
|
| 337 |
|
|
|a ƒaComputermedien
|b c
|2 rdamedia
|
| 338 |
|
|
|a ƒa Online-Ressource
|b cr
|2 rdacarrier
|
| 500 |
|
|
|a Date Completed 10.08.2022
|
| 500 |
|
|
|a Date Revised 29.08.2022
|
| 500 |
|
|
|a published: Print-Electronic
|
| 500 |
|
|
|a Citation Status MEDLINE
|
| 520 |
|
|
|a A novel Bi4Ti3O12/g-C3N4/BiOBr(BTO/CN/BOB) composite was synthesized by a solvothermal-mechanical mixed thermal method. The composition, structure, and micromorphology of the samples were analyzed. The BTO/CN/BOB composite photocatalyst shows better photocatalytic performance for tetracycline hydrochloride (TC) degradation compared to Bi4Ti3O12 and binary composite photocatalysts. The highest degradation rate of TC can reach 89.84% using the BTO/CN/BOB photocatalyst under the optimal conditions, and BTO/CN/BOB still exhibits good photocatalytic properties after recycling. Moreover, it also shows good photodegradation activity for different kinds of antibiotics, implying its wide application prospect. The photocatalytic performance and reuse stability of BTO/CN/BOB were significantly improved, which may be because of the enhanced spectral absorption range and efficient electron transfer capability by the synergistic effect and interaction among Bi4Ti3O12, BiOBr, and g-C3N4. Finally, the possible degradation pathway and electron transfer mechanism of the dual Z-scheme heterojunction are proposed
|
| 650 |
|
4 |
|a Journal Article
|
| 650 |
|
4 |
|a Research Support, Non-U.S. Gov't
|
| 650 |
|
7 |
|a Anti-Bacterial Agents
|2 NLM
|
| 650 |
|
7 |
|a Titanium
|2 NLM
|
| 650 |
|
7 |
|a D1JT611TNE
|2 NLM
|
| 650 |
|
7 |
|a bismuth oxybromide
|2 NLM
|
| 650 |
|
7 |
|a N427L0NH3S
|2 NLM
|
| 650 |
|
7 |
|a Bismuth
|2 NLM
|
| 650 |
|
7 |
|a U015TT5I8H
|2 NLM
|
| 700 |
1 |
|
|a Zhu, Pengfei
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Xu, Jing
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Duan, Ming
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Zhang, Shasha
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Wu, Xiaolong
|e verfasserin
|4 aut
|
| 773 |
0 |
8 |
|i Enthalten in
|t Langmuir : the ACS journal of surfaces and colloids
|d 1992
|g 38(2022), 31 vom: 09. Aug., Seite 9532-9545
|w (DE-627)NLM098181009
|x 1520-5827
|7 nnns
|
| 773 |
1 |
8 |
|g volume:38
|g year:2022
|g number:31
|g day:09
|g month:08
|g pages:9532-9545
|
| 856 |
4 |
0 |
|u http://dx.doi.org/10.1021/acs.langmuir.2c00907
|3 Volltext
|
| 912 |
|
|
|a GBV_USEFLAG_A
|
| 912 |
|
|
|a SYSFLAG_A
|
| 912 |
|
|
|a GBV_NLM
|
| 912 |
|
|
|a GBV_ILN_22
|
| 912 |
|
|
|a GBV_ILN_350
|
| 912 |
|
|
|a GBV_ILN_721
|
| 951 |
|
|
|a AR
|
| 952 |
|
|
|d 38
|j 2022
|e 31
|b 09
|c 08
|h 9532-9545
|