|
|
|
|
| LEADER |
01000caa a22002652c 4500 |
| 001 |
NLM261625039 |
| 003 |
DE-627 |
| 005 |
20250220073959.0 |
| 007 |
cr uuu---uuuuu |
| 008 |
231224s2016 xx |||||o 00| ||eng c |
| 024 |
7 |
|
|a 10.1021/acs.langmuir.6b01370
|2 doi
|
| 028 |
5 |
2 |
|a pubmed25n0872.xml
|
| 035 |
|
|
|a (DE-627)NLM261625039
|
| 035 |
|
|
|a (NLM)27328628
|
| 040 |
|
|
|a DE-627
|b ger
|c DE-627
|e rakwb
|
| 041 |
|
|
|a eng
|
| 100 |
1 |
|
|a Yamanoi, Yoshinori
|e verfasserin
|4 aut
|
| 245 |
1 |
0 |
|a Effective Method for Micro-Patterning Arene-Terminated Monolayers on a Si(111) Electrode
|
| 264 |
|
1 |
|c 2016
|
| 336 |
|
|
|a Text
|b txt
|2 rdacontent
|
| 337 |
|
|
|a ƒaComputermedien
|b c
|2 rdamedia
|
| 338 |
|
|
|a ƒa Online-Ressource
|b cr
|2 rdacarrier
|
| 500 |
|
|
|a Date Completed 30.05.2018
|
| 500 |
|
|
|a Date Revised 30.05.2018
|
| 500 |
|
|
|a published: Print-Electronic
|
| 500 |
|
|
|a Citation Status PubMed-not-MEDLINE
|
| 520 |
|
|
|a Microstructured electrodes are significant to modern electrochemistry. A representative aromatic group, 4-ferrocenylphenyl one, was covalently bound to a micropatterned silicon electrode via the arylation of a hydrogen-terminated silicon(111) surface formed selectively on a Si wafer. Starting from a silicon(100)-on-insulator (SOI) wafer, the aromatic monolayer was attached sequentially by spin-coating a resist, electron beam lithography, Cr/Au deposition, lift-off, anisotropic etching with aqueous KOH solution, and Pd-catalyzed arylation. Cyclic voltammetry (CV) and X-ray photoelectron spectroscopy (XPS) are used to characterize the coupling reaction between 4-ferrocenyl group and silicon substrate, and to confirm performance of the final modified microsized electrode. These data show that this synthetic protocol gives chemically well-defined and robust functionalized monolayers on a silicon semiconducting surface with a small electrode
|
| 650 |
|
4 |
|a Journal Article
|
| 650 |
|
4 |
|a Research Support, Non-U.S. Gov't
|
| 700 |
1 |
|
|a Kobayashi, Tetsuhiro
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Maeda, Hiroaki
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Miyachi, Mariko
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Ara, Masato
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Tada, Hirokazu
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Nishihara, Hiroshi
|e verfasserin
|4 aut
|
| 773 |
0 |
8 |
|i Enthalten in
|t Langmuir : the ACS journal of surfaces and colloids
|d 1985
|g 32(2016), 27 vom: 12. Juli, Seite 6825-9
|w (DE-627)NLM098181009
|x 1520-5827
|7 nnas
|
| 773 |
1 |
8 |
|g volume:32
|g year:2016
|g number:27
|g day:12
|g month:07
|g pages:6825-9
|
| 856 |
4 |
0 |
|u http://dx.doi.org/10.1021/acs.langmuir.6b01370
|3 Volltext
|
| 912 |
|
|
|a GBV_USEFLAG_A
|
| 912 |
|
|
|a SYSFLAG_A
|
| 912 |
|
|
|a GBV_NLM
|
| 912 |
|
|
|a GBV_ILN_22
|
| 912 |
|
|
|a GBV_ILN_350
|
| 912 |
|
|
|a GBV_ILN_721
|
| 951 |
|
|
|a AR
|
| 952 |
|
|
|d 32
|j 2016
|e 27
|b 12
|c 07
|h 6825-9
|