|
|
|
|
LEADER |
01000caa a22002652 4500 |
001 |
NLM190992840 |
003 |
DE-627 |
005 |
20250210175429.0 |
007 |
tu |
008 |
231223s2009 xx ||||| 00| ||eng c |
028 |
5 |
2 |
|a pubmed25n0637.xml
|
035 |
|
|
|a (DE-627)NLM190992840
|
035 |
|
|
|a (NLM)19714885
|
040 |
|
|
|a DE-627
|b ger
|c DE-627
|e rakwb
|
041 |
|
|
|a eng
|
100 |
1 |
|
|a Jackson, A J
|e verfasserin
|4 aut
|
245 |
1 |
0 |
|a Structure of partially fluorinated surfactant monolayers at the air-water interface
|
264 |
|
1 |
|c 2009
|
336 |
|
|
|a Text
|b txt
|2 rdacontent
|
337 |
|
|
|a ohne Hilfsmittel zu benutzen
|b n
|2 rdamedia
|
338 |
|
|
|a Band
|b nc
|2 rdacarrier
|
500 |
|
|
|a Date Completed 22.09.2009
|
500 |
|
|
|a Date Revised 27.10.2019
|
500 |
|
|
|a published: Print
|
500 |
|
|
|a Citation Status PubMed-not-MEDLINE
|
520 |
|
|
|a Partially fluorinated cationic surfactants of the form C(n)F(2n+1)C(m)H(2m)N(CH3)Br have been prepared, and their behavior at the air-water interface has been studied using surface tension measurements and neutron reflectometry. The degree of fluorination has been varied while keeping the overall chain lengths similar. The results are compared with those previously obtained for C16H33N(CH3)Br (C16TAB). The structural studies show a decrease in molecular orientation with increasing fluorination. The mean tilt away from the surface normal varies from 55 degrees for C16TAB to 25 degrees for C8F17C6H12N(CH3)Br. The interfacial layer roughness is observed to be lower than that expected for a pure fluorocarbon surfactant
|
650 |
|
4 |
|a Journal Article
|
700 |
1 |
|
|a Li, P X
|e verfasserin
|4 aut
|
700 |
1 |
|
|a Dong, C C
|e verfasserin
|4 aut
|
700 |
1 |
|
|a Thomas, R K
|e verfasserin
|4 aut
|
700 |
1 |
|
|a Penfold, J
|e verfasserin
|4 aut
|
773 |
0 |
8 |
|i Enthalten in
|t Langmuir : the ACS journal of surfaces and colloids
|d 1991
|g 25(2009), 7 vom: 07. Apr., Seite 3957-65
|w (DE-627)NLM098181009
|x 1520-5827
|7 nnns
|
773 |
1 |
8 |
|g volume:25
|g year:2009
|g number:7
|g day:07
|g month:04
|g pages:3957-65
|
912 |
|
|
|a GBV_USEFLAG_A
|
912 |
|
|
|a SYSFLAG_A
|
912 |
|
|
|a GBV_NLM
|
912 |
|
|
|a GBV_ILN_22
|
912 |
|
|
|a GBV_ILN_350
|
912 |
|
|
|a GBV_ILN_721
|
951 |
|
|
|a AR
|
952 |
|
|
|d 25
|j 2009
|e 7
|b 07
|c 04
|h 3957-65
|