|
|
|
|
| LEADER |
01000naa a22002652 4500 |
| 001 |
NLM169711366 |
| 003 |
DE-627 |
| 005 |
20231223121927.0 |
| 007 |
tu |
| 008 |
231223s2007 xx ||||| 00| ||eng c |
| 028 |
5 |
2 |
|a pubmed24n0566.xml
|
| 035 |
|
|
|a (DE-627)NLM169711366
|
| 035 |
|
|
|a (NLM)17439164
|
| 040 |
|
|
|a DE-627
|b ger
|c DE-627
|e rakwb
|
| 041 |
|
|
|a eng
|
| 100 |
1 |
|
|a Sharma, Suraj Chandra
|e verfasserin
|4 aut
|
| 245 |
1 |
0 |
|a Viscoelastic micellar solutions in a mixed nonionic fluorinated surfactants system and the effect of oils
|
| 264 |
|
1 |
|c 2007
|
| 336 |
|
|
|a Text
|b txt
|2 rdacontent
|
| 337 |
|
|
|a ohne Hilfsmittel zu benutzen
|b n
|2 rdamedia
|
| 338 |
|
|
|a Band
|b nc
|2 rdacarrier
|
| 500 |
|
|
|a Date Completed 27.06.2007
|
| 500 |
|
|
|a Date Revised 01.05.2007
|
| 500 |
|
|
|a published: Print-Electronic
|
| 500 |
|
|
|a Citation Status PubMed-not-MEDLINE
|
| 520 |
|
|
|a Formation and rheological behavior of viscoelastic wormlike micelles in aqueous solution of a mixed system of nonionic fluorinated surfactants, perfluoroalkyl sulfonamide ethoxylate, C8F17SO2N(C3H7)(CH2CH2O)nH (abbreviated as C8F17EOn) was studied. In the water-surfactant binary system C8F17EO20 forms an isotropic micellar solution over wide concentration range (>85 wt %) at 25 degrees C. With successive addition of C8F17EO1 to the aqueous C8F17EO20 solution, viscosity of the solution increases swiftly, and a viscoelastic solution is formed. The oscillatory rheological behavior of the viscoelastic solution can be described by Maxwell model at low-frequency region, which is typical of wormlike micelles. With further addition of C8F17EO1, the viscosity decreases after a maximum and phase separation occurs. Addition of a small amount of fluorinated oils to the wormlike micellar solution disrupts the network structure and decreases the viscosity sharply. It is found that polymeric oil, PFP (F-(C3F6O)nCF2CF2COOH), decreases the viscosity more effectively than the perfluorodecalin (PFD). The difference in the effect of oil on rheological properties is explained in terms of the solubilization site of the oils in the hydrophobic interior of the cylindrical aggregates, and their ability to induce rod-sphere transition
|
| 650 |
|
4 |
|a Journal Article
|
| 700 |
1 |
|
|a Acharya, Durga P
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Aramaki, Kenji
|e verfasserin
|4 aut
|
| 773 |
0 |
8 |
|i Enthalten in
|t Langmuir : the ACS journal of surfaces and colloids
|d 1992
|g 23(2007), 10 vom: 08. Mai, Seite 5324-30
|w (DE-627)NLM098181009
|x 1520-5827
|7 nnns
|
| 773 |
1 |
8 |
|g volume:23
|g year:2007
|g number:10
|g day:08
|g month:05
|g pages:5324-30
|
| 912 |
|
|
|a GBV_USEFLAG_A
|
| 912 |
|
|
|a SYSFLAG_A
|
| 912 |
|
|
|a GBV_NLM
|
| 912 |
|
|
|a GBV_ILN_22
|
| 912 |
|
|
|a GBV_ILN_350
|
| 912 |
|
|
|a GBV_ILN_721
|
| 951 |
|
|
|a AR
|
| 952 |
|
|
|d 23
|j 2007
|e 10
|b 08
|c 05
|h 5324-30
|