|
|
|
|
| LEADER |
01000naa a22002652 4500 |
| 001 |
NLM160546613 |
| 003 |
DE-627 |
| 005 |
20231223090322.0 |
| 007 |
tu |
| 008 |
231223s2006 xx ||||| 00| ||eng c |
| 028 |
5 |
2 |
|a pubmed24n0535.xml
|
| 035 |
|
|
|a (DE-627)NLM160546613
|
| 035 |
|
|
|a (NLM)16460082
|
| 040 |
|
|
|a DE-627
|b ger
|c DE-627
|e rakwb
|
| 041 |
|
|
|a eng
|
| 100 |
1 |
|
|a Dreger, Katharina
|e verfasserin
|4 aut
|
| 245 |
1 |
0 |
|a Synthesis and surface properties of new ureas and amides at different interfaces
|
| 264 |
|
1 |
|c 2006
|
| 336 |
|
|
|a Text
|b txt
|2 rdacontent
|
| 337 |
|
|
|a ohne Hilfsmittel zu benutzen
|b n
|2 rdamedia
|
| 338 |
|
|
|a Band
|b nc
|2 rdacarrier
|
| 500 |
|
|
|a Date Completed 09.05.2007
|
| 500 |
|
|
|a Date Revised 21.11.2013
|
| 500 |
|
|
|a published: Print
|
| 500 |
|
|
|a Citation Status MEDLINE
|
| 520 |
|
|
|a The influence of the urea and amide group in the alkyl chain of methyl nonadecanoate on the surface properties is investigated and compared. For that purpose, the ureas CH3O2C-(CH2)m-NHCONH-(CH2)n-CH3 (n + m = 14) [1 (m = 2), 3 (m = 3), and 5 (m = 4)] and the amides CH3O2C-(CH2)m-NHCO-(CH2)n-CH3 (n + m = 15) [2(m = 2), 4 (m = 3), and 6 (m = 4)] were synthesized. The pi/A isotherms of the ureas show up to the attainable temperature of 313 K no LE phase, which indicates a very stable LC phase. The amides exhibit a two phase plateau region, with the exception of 2. The different behavior is connected with the hydrogen bond energies, which are stronger with the ureas in the LC than in the LE phase, whereas those of the amides have a similar strength in both phases. The effect of hydrogen bonds in self-assembled molecules of N,N'-dialkylurea CH3-(CH2)m-NHCONH-(CH2)n-CH3 (m + n = 14) [7 (n = 2)] was visualized by STM at the octylbenzene/graphite interface. Compound 7 forms a lamella structure with a periodicity of one molecule length. The tilt angle of 86 degrees +/- 2 degrees to the edge of the lamella points to a nearly orthogonal arrangement of the molecules. It indicates two equivalent bonds between the aza-hydrogens and the carbonyl oxygen. A similar arrangement is proposed for the LC phase of the ureas at the air/water interface
|
| 650 |
|
4 |
|a Journal Article
|
| 650 |
|
4 |
|a Research Support, Non-U.S. Gov't
|
| 650 |
|
7 |
|a Amides
|2 NLM
|
| 650 |
|
7 |
|a Benzene Derivatives
|2 NLM
|
| 650 |
|
7 |
|a Graphite
|2 NLM
|
| 650 |
|
7 |
|a 7782-42-5
|2 NLM
|
| 650 |
|
7 |
|a Urea
|2 NLM
|
| 650 |
|
7 |
|a 8W8T17847W
|2 NLM
|
| 700 |
1 |
|
|a Zou, Bo
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Mu, Zhongcheng
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Galla, Hans Joachim
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Chi, Lifeng
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Fuchs, Harald
|e verfasserin
|4 aut
|
| 700 |
1 |
|
|a Schäfer, Hans J
|e verfasserin
|4 aut
|
| 773 |
0 |
8 |
|i Enthalten in
|t Langmuir : the ACS journal of surfaces and colloids
|d 1992
|g 22(2006), 4 vom: 14. Feb., Seite 1619-25
|w (DE-627)NLM098181009
|x 1520-5827
|7 nnns
|
| 773 |
1 |
8 |
|g volume:22
|g year:2006
|g number:4
|g day:14
|g month:02
|g pages:1619-25
|
| 912 |
|
|
|a GBV_USEFLAG_A
|
| 912 |
|
|
|a SYSFLAG_A
|
| 912 |
|
|
|a GBV_NLM
|
| 912 |
|
|
|a GBV_ILN_22
|
| 912 |
|
|
|a GBV_ILN_350
|
| 912 |
|
|
|a GBV_ILN_721
|
| 951 |
|
|
|a AR
|
| 952 |
|
|
|d 22
|j 2006
|e 4
|b 14
|c 02
|h 1619-25
|